Products 2287331-65-9

CAS 2287331-65-9 is the registry number for Ethyl 3-amino-6-butylthieno(2,3-b)pyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-6-butylthieno[2,3-b]pyridine-2-carboxylate (CAS 2287331-65-9) is a chemical compound with the molecular formula C14H18N2O2S and a molecular weight of 278.37 g/mol. IUPAC name: ethyl 3-amino-6-butylthieno[2,3-b]pyridine-2-carboxylate. InChIKey: BDBJAGZHHPTQTE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18N2O2S
Molecular weight278.37 g/mol
IUPAC nameethyl 3-amino-6-butylthieno[2,3-b]pyridine-2-carboxylate
InChIKeyBDBJAGZHHPTQTE-UHFFFAOYSA-N
SMILESCCCCC1=NC2=C(C=C1)C(=C(S2)C(=O)OCC)N

Computed by PubChem (NCBI)