CAS 6059-62-7 is the registry number for Dansyl-dimethylamine, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
5-(dimethylamino)-N,N-dimethylnaphthalene-1-sulfonamide (CAS 6059-62-7) is a chemical compound with the molecular formula C14H18N2O2S and a molecular weight of 278.37 g/mol. IUPAC name: 5-(dimethylamino)-N,N-dimethylnaphthalene-1-sulfonamide. InChIKey: AIMUHKITGKVNPD-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2S |
|---|---|
| Molecular weight | 278.37 g/mol |
| IUPAC name | 5-(dimethylamino)-N,N-dimethylnaphthalene-1-sulfonamide |
| InChIKey | AIMUHKITGKVNPD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)