CAS 2138187-58-1 is the registry number for rac-2-((1R,2R)-2-Benzylcyclopropyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(1S,2S)-2-benzylcyclopropyl]ethanol (CAS 2138187-58-1) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 2-[(1S,2S)-2-benzylcyclopropyl]ethanol. InChIKey: IRLIVFFFNALBOS-VXGBXAGGSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 2-[(1S,2S)-2-benzylcyclopropyl]ethanol |
| InChIKey | IRLIVFFFNALBOS-VXGBXAGGSA-N |
| SMILES | C1[C@H]([C@@H]1CC2=CC=CC=C2)CCO |
Computed by PubChem (NCBI)