CAS 2138198-80-6 is the registry number for 1H,2H,3H,4H,5H-Pyrido(3,4-b)azepine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3,4,5-tetrahydro-1H-pyrido[3,4-b]azepine;dihydrochloride (CAS 2138198-80-6) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 2,3,4,5-tetrahydro-1H-pyrido[3,4-b]azepine;dihydrochloride. InChIKey: FLFBMWPMLUZYNY-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 2,3,4,5-tetrahydro-1H-pyrido[3,4-b]azepine;dihydrochloride |
| InChIKey | FLFBMWPMLUZYNY-UHFFFAOYSA-N |
| SMILES | C1CCNC2=C(C1)C=CN=C2.Cl.Cl |
Computed by PubChem (NCBI)