Products 2138223-66-0
CAS 2138223-66-0 is the registry number for 3-[4-fluoro-3-(trifluoromethyl)phenyl]-1H-pyrazole, 97%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
5-[4-fluoro-3-(trifluoromethyl)phenyl]-1H-pyrazole (CAS 2138223-66-0) is a chemical compound with the molecular formula C10H6F4N2 and a molecular weight of 230.16 g/mol. IUPAC name: 5-[4-fluoro-3-(trifluoromethyl)phenyl]-1H-pyrazole. InChIKey: MQUYGRVFFFDSGO-UHFFFAOYSA-N.
| Molecular formula | C10H6F4N2 |
|---|---|
| Molecular weight | 230.16 g/mol |
| IUPAC name | 5-[4-fluoro-3-(trifluoromethyl)phenyl]-1H-pyrazole |
| InChIKey | MQUYGRVFFFDSGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=NN2)C(F)(F)F)F |
Computed by PubChem (NCBI)