Products 2138266-64-3
CAS 2138266-64-3 is the registry number for rac-(2R,3S)-3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)oxolane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-2-carboxylic acid (CAS 2138266-64-3) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-2-carboxylic acid. InChIKey: NUCSYZBFEPVWSU-ZWKOTPCHSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-2-carboxylic acid |
| InChIKey | NUCSYZBFEPVWSU-ZWKOTPCHSA-N |
| SMILES | C1CO[C@H]([C@H]1NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)