CAS 2138274-19-6 is the registry number for 4-Amino-3-(2,3-dihydro-1-benzofuran-5-yl)butanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-3-(2,3-dihydro-1-benzofuran-5-yl)butanoic acid;hydrochloride (CAS 2138274-19-6) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: 4-amino-3-(2,3-dihydro-1-benzofuran-5-yl)butanoic acid;hydrochloride. InChIKey: LQVJLRDAGFSJCS-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 4-amino-3-(2,3-dihydro-1-benzofuran-5-yl)butanoic acid;hydrochloride |
| InChIKey | LQVJLRDAGFSJCS-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C(CC(=O)O)CN.Cl |
Computed by PubChem (NCBI)