Products 2138390-08-4

CAS 2138390-08-4 is the registry number for tert-Butyl N-{5-oxospiro(2.3)hexan-1-yl}carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(5-oxospiro[2.3]hexan-2-yl)carbamate (CAS 2138390-08-4) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl N-(5-oxospiro[2.3]hexan-2-yl)carbamate. InChIKey: NOHPNCADBPHBEG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO3
Molecular weight211.26 g/mol
IUPAC nametert-butyl N-(5-oxospiro[2.3]hexan-2-yl)carbamate
InChIKeyNOHPNCADBPHBEG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CC12CC(=O)C2

Computed by PubChem (NCBI)