Products 2138461-99-9
CAS 2138461-99-9 is the registry number for XDM-CBP. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-acetyl-N-[(2,8-dihydroxynaphthalen-1-yl)methyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide (CAS 2138461-99-9) is a chemical compound with the molecular formula C21H22N2O4 and a molecular weight of 366.4 g/mol. IUPAC name: 4-acetyl-N-[(2,8-dihydroxynaphthalen-1-yl)methyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide. InChIKey: KCGVENSOXCWCNF-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 4-acetyl-N-[(2,8-dihydroxynaphthalen-1-yl)methyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide |
| InChIKey | KCGVENSOXCWCNF-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC(=C1C(=O)C)C)C(=O)NCC2=C(C=CC3=C2C(=CC=C3)O)O |
Computed by PubChem (NCBI)
Synonyms:
XDM-CBP, orb1703335