CAS 2138475-71-3 is the registry number for rel-(1R,5S,6r)-3,3-Difluorobicyclo[3.1.0]hexan-6-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5S)-3,3-difluorobicyclo[3.1.0]hexan-6-amine (CAS 2138475-71-3) is a chemical compound with the molecular formula C6H9F2N and a molecular weight of 133.14 g/mol. IUPAC name: (1R,5S)-3,3-difluorobicyclo[3.1.0]hexan-6-amine. InChIKey: DWARKUKQBSIXRI-NGQZWQHPSA-N.
| Molecular formula | C6H9F2N |
|---|---|
| Molecular weight | 133.14 g/mol |
| IUPAC name | (1R,5S)-3,3-difluorobicyclo[3.1.0]hexan-6-amine |
| InChIKey | DWARKUKQBSIXRI-NGQZWQHPSA-N |
| SMILES | C1[C@@H]2[C@@H](C2N)CC1(F)F |
Computed by PubChem (NCBI)