Products 213912-46-0
CAS 213912-46-0 is the registry number for Barbacarpan. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 10 mg, 5 mg, 1 mg.
(1R,12R)-7-prop-1-en-2-yl-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaen-16-ol (CAS 213912-46-0) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: (1R,12R)-7-prop-1-en-2-yl-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaen-16-ol. InChIKey: MVIZRSMIUOYJNY-NUSPTKLCSA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (1R,12R)-7-prop-1-en-2-yl-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaen-16-ol |
| InChIKey | MVIZRSMIUOYJNY-NUSPTKLCSA-N |
| SMILES | CC(=C)C1CC2=C(O1)C=CC3=C2O[C@@H]4[C@H]3COC5=C4C=CC(=C5)O |
Computed by PubChem (NCBI)
Synonyms:
Barbacarpan, orb1683091