CAS 213971-34-7 appears in our catalog under these names: 2,3-Dihydroxy-6-methyl-7-(phenylmethyl)-4-propyl-1-naphthalenecarboxylic Acid, FX-11/ 98.95% (existing batch purity), FX-11 99%, Lactate Dehydrogenase A Inhibitor, FX11, 2,3-Dihydroxy-6-methyl-7-(phenylmethyl)-4-propyl-1-naphthalenecarboxylic Acid, 99%, 99%. Offered by: TRC, TargetMol, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 0,5mg, 25mg, 5mg, 1mg, 250mg, 10mg, 50mg, 100mg.
7-benzyl-2,3-dihydroxy-6-methyl-4-propylnaphthalene-1-carboxylic acid (CAS 213971-34-7) is a chemical compound with the molecular formula C22H22O4 and a molecular weight of 350.4 g/mol. IUPAC name: 7-benzyl-2,3-dihydroxy-6-methyl-4-propylnaphthalene-1-carboxylic acid. InChIKey: LVPYVYFMCKYFCZ-UHFFFAOYSA-N.
| Molecular formula | C22H22O4 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 7-benzyl-2,3-dihydroxy-6-methyl-4-propylnaphthalene-1-carboxylic acid |
| InChIKey | LVPYVYFMCKYFCZ-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C(=C(C2=C1C=C(C(=C2)CC3=CC=CC=C3)C)C(=O)O)O)O |
Computed by PubChem (NCBI)