CAS 84-19-5 appears in our catalog under these names: Dienestrol diacetate, 95%, 3,4–Bis(4–acetoxyphenyl)–2,4–hexadiene,95%, Dienestrol Diacetate, >95.0%(GC), Phenol, 4,4′-(1,2-diethylidene-1,2-ethanediyl)bis-, 1,1′-diacetate, Dienestrol diacetate. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, Get quote.
[4-[(2E,4E)-4-(4-acetyloxyphenyl)hexa-2,4-dien-3-yl]phenyl] acetate (CAS 84-19-5) is a chemical compound with the molecular formula C22H22O4 and a molecular weight of 350.4 g/mol. IUPAC name: [4-[(2E,4E)-4-(4-acetyloxyphenyl)hexa-2,4-dien-3-yl]phenyl] acetate. InChIKey: YWLLGDVBTLPARJ-OXAZHYLESA-N.
| Molecular formula | C22H22O4 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | [4-[(2E,4E)-4-(4-acetyloxyphenyl)hexa-2,4-dien-3-yl]phenyl] acetate |
| InChIKey | YWLLGDVBTLPARJ-OXAZHYLESA-N |
| SMILES | C/C=C(/C(=C/C)/C1=CC=C(C=C1)OC(=O)C)\C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)