Products 24705-62-2
CAS 24705-62-2 is the registry number for Z,Z-Dienestrol Diacetate. Offered by: TRC. Available pack sizes: 100mg, 10mg.
[4-[(2Z,4Z)-4-(4-acetyloxyphenyl)hexa-2,4-dien-3-yl]phenyl] acetate (CAS 24705-62-2) is a chemical compound with the molecular formula C22H22O4 and a molecular weight of 350.4 g/mol. IUPAC name: [4-[(2Z,4Z)-4-(4-acetyloxyphenyl)hexa-2,4-dien-3-yl]phenyl] acetate. InChIKey: YWLLGDVBTLPARJ-CMDWGMEOSA-N.
| Molecular formula | C22H22O4 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | [4-[(2Z,4Z)-4-(4-acetyloxyphenyl)hexa-2,4-dien-3-yl]phenyl] acetate |
| InChIKey | YWLLGDVBTLPARJ-CMDWGMEOSA-N |
| SMILES | C/C=C(\C(=C/C)\C1=CC=C(C=C1)OC(=O)C)/C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Isodienestrol diacetate, beta-Dienestrol diacetate, Dienestrol diacetate, beta-, Phenol, 4,4'-(1,2-diethylidene-1,2-ethanediyl)bis-, diacetate, (Z,Z)-, .BETA.-DIENESTROL DIACETATE, DIENESTROL DIACETATE, .BETA.-, Z,Z-Dienestrol Diacetate, [4-[(2Z,4Z)-4-(4-acetyloxyphenyl)hexa-2,4-dien-3-yl]phenyl] acetate