CAS 60078-97-9 appears in our catalog under these names: 1–Phenyl–3–(2,4,6–trimethylphenyl)–2–pyrazoline, 1-Phenyl-3-(2,4,6-trimethylphenyl)-2-pyrazoline, >98.0%(GC), 3-Mesityl-1-phenyl-4,5-dihydro-1H-pyrazole 98%, 3-Mesityl-1-phenyl-4,5-dihydro-1H-pyrazole, 98%, 98%, 3-Mesityl-1-phenyl-4,5-dihydro-1H-pyrazole, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
2-phenyl-5-(2,4,6-trimethylphenyl)-3,4-dihydropyrazole (CAS 60078-97-9) is a chemical compound with the molecular formula C18H20N2 and a molecular weight of 264.4 g/mol. IUPAC name: 2-phenyl-5-(2,4,6-trimethylphenyl)-3,4-dihydropyrazole. InChIKey: BJEAUUFMQKUXAX-UHFFFAOYSA-N.
| Molecular formula | C18H20N2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 2-phenyl-5-(2,4,6-trimethylphenyl)-3,4-dihydropyrazole |
| InChIKey | BJEAUUFMQKUXAX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=NN(CC2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)