CAS 2140-41-2 appears in our catalog under these names: 2-O-Methyl-D-glucopyranose, 2-O-Methyl-D-glucose, 2-O-Methyl-D-glucose, >95% (HPLC), (3R,4S,5S,6R)–6–(hydroxymethyl)–3–methoxytetrahydro–2H–pyran–2,4,5–triol. Offered by: Chemat, Biosynth, TRC, GLPBio. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 10mg, 5mg.
(3R,4S,5S,6R)-6-(hydroxymethyl)-3-methoxyoxane-2,4,5-triol (CAS 2140-41-2) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (3R,4S,5S,6R)-6-(hydroxymethyl)-3-methoxyoxane-2,4,5-triol. InChIKey: UMPNFVHHMOSNAC-WLDMJGECSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (3R,4S,5S,6R)-6-(hydroxymethyl)-3-methoxyoxane-2,4,5-triol |
| InChIKey | UMPNFVHHMOSNAC-WLDMJGECSA-N |
| SMILES | CO[C@@H]1[C@H]([C@@H]([C@H](OC1O)CO)O)O |
Computed by PubChem (NCBI)