Products 214074-24-5
CAS 214074-24-5 is the registry number for 3-Hydroxy-2-methyl Isoborneol. Offered by: TRC. Available pack sizes: 250mg.
1,2,7,7-tetramethylbicyclo[2.2.1]heptane-2,3-diol (CAS 214074-24-5) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: 1,2,7,7-tetramethylbicyclo[2.2.1]heptane-2,3-diol. InChIKey: GROZVIRKNWHGSN-UHFFFAOYSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | 1,2,7,7-tetramethylbicyclo[2.2.1]heptane-2,3-diol |
| InChIKey | GROZVIRKNWHGSN-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(C2O)(C)O)C)C |
Computed by PubChem (NCBI)