Products 21413-77-4
CAS 21413-77-4 is the registry number for 3-Chloro-6,7,8,9-tetrahydro-5H-benzo(7)annulen-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (CAS 21413-77-4) is a chemical compound with the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. IUPAC name: 3-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one. InChIKey: MAZWTWNQNWOKGG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 3-chloro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| InChIKey | MAZWTWNQNWOKGG-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=C(C1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)