CAS 876404-83-0 is the registry number for Ethyl (S)-3-hydroxy-4,4-dimethylpentanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Ethyl (3S)-3-hydroxy-4,4-dimethylpentanoate (CAS 876404-83-0) is a chemical compound with the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. IUPAC name: ethyl (3S)-3-hydroxy-4,4-dimethylpentanoate. InChIKey: QVXYZSSTMJIRPF-ZETCQYMHSA-N.
| Molecular formula | C9H18O3 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | ethyl (3S)-3-hydroxy-4,4-dimethylpentanoate |
| InChIKey | QVXYZSSTMJIRPF-ZETCQYMHSA-N |
| SMILES | CCOC(=O)C[C@@H](C(C)(C)C)O |
Computed by PubChem (NCBI)