CAS 21424-82-8 appears in our catalog under these names: 3-Aceto-2-hydroxybiphenyl, 95+%, 3–Aceto–2–hydroxybiphenyl, 1-(2-Hydroxy[1,1'-biphenyl]-3-yl)ethanone, 95%, 95%, 1-(2-HYDROXY-[1,1'-BIPHENYL]-3-YL)ETHANONE, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1-(2-hydroxy-3-phenylphenyl)ethanone (CAS 21424-82-8) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 1-(2-hydroxy-3-phenylphenyl)ethanone. InChIKey: XFRAXOKMMRIWKK-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 1-(2-hydroxy-3-phenylphenyl)ethanone |
| InChIKey | XFRAXOKMMRIWKK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC(=C1O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)