Products 21428-65-9

CAS 21428-65-9 is the registry number for 2,2-Dibromo-5,5-dimethylcyclohexane-1,3-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

2,2-dibromo-5,5-dimethylcyclohexane-1,3-dione (CAS 21428-65-9) is a chemical compound with the molecular formula C8H10Br2O2 and a molecular weight of 297.97 g/mol. IUPAC name: 2,2-dibromo-5,5-dimethylcyclohexane-1,3-dione. InChIKey: MFVLTURDATWEKO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10Br2O2
Molecular weight297.97 g/mol
IUPAC name2,2-dibromo-5,5-dimethylcyclohexane-1,3-dione
InChIKeyMFVLTURDATWEKO-UHFFFAOYSA-N
SMILESCC1(CC(=O)C(C(=O)C1)(Br)Br)C

Computed by PubChem (NCBI)