Products 72691-18-0
CAS 72691-18-0 is the registry number for 1S-cis-Decamethrinic Acid. Offered by: TRC. Available pack sizes: 100mg.
3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 72691-18-0) is a chemical compound with the molecular formula C8H10Br2O2 and a molecular weight of 297.97 g/mol. IUPAC name: 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: MDIQXIJPQWLFSD-UHFFFAOYSA-N.
| Molecular formula | C8H10Br2O2 |
|---|---|
| Molecular weight | 297.97 g/mol |
| IUPAC name | 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | MDIQXIJPQWLFSD-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)O)C=C(Br)Br)C |
Computed by PubChem (NCBI)
Synonyms:
3-(2,2-dibromovinyl)-2,2-dimethylcyclopropane-1-carboxylic acid, DBCA acid, DDPC acid, 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid, 1S-cis-Decamethrinic Acid, C8H10Br2O2, (1S-trans)-Decamethrinic Acid, cis-Dibromocypermethric acid, Deltamethrin Impurity 1 (Mixture of Diastereomers)