Products 74560-76-2
CAS 74560-76-2 is the registry number for (1S-trans)-Decamethrinic Acid. Offered by: TRC. Available pack sizes: 250mg.
Cis-(1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 74560-76-2) is a chemical compound with the molecular formula C8H10Br2O2 and a molecular weight of 297.97 g/mol. IUPAC name: cis-(1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: MDIQXIJPQWLFSD-UJURSFKZSA-N.
| Molecular formula | C8H10Br2O2 |
|---|---|
| Molecular weight | 297.97 g/mol |
| IUPAC name | cis-(1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | MDIQXIJPQWLFSD-UJURSFKZSA-N |
| SMILES | CC1([C@H]([C@@H]1C(=O)O)C=C(Br)Br)C |
Computed by PubChem (NCBI)