Products 214283-58-6
CAS 214283-58-6 is the registry number for 3,4-Didehydroglabridin. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)benzene-1,3-diol (CAS 214283-58-6) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)benzene-1,3-diol. InChIKey: DGKSRSQXQWIQTH-UHFFFAOYSA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)benzene-1,3-diol |
| InChIKey | DGKSRSQXQWIQTH-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC3=C2OCC(=C3)C4=C(C=C(C=C4)O)O)C |
Computed by PubChem (NCBI)