CAS 214402-34-3 is the registry number for (4R)-4-{((tert-Butoxy)carbonyl)amino}pentanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 214402-34-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: CVYVXURBKURNKE-SSDOTTSWSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | CVYVXURBKURNKE-SSDOTTSWSA-N |
| SMILES | C[C@H](CCC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)