CAS 214614-61-6 is the registry number for 2-(4-Methanesulfonylphenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(4-methylsulfonylphenyl)ethanol (CAS 214614-61-6) is a chemical compound with the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. IUPAC name: 2-(4-methylsulfonylphenyl)ethanol. InChIKey: ZHHRUHAQUDFOGD-UHFFFAOYSA-N.
| Molecular formula | C9H12O3S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 2-(4-methylsulfonylphenyl)ethanol |
| InChIKey | ZHHRUHAQUDFOGD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CCO |
Computed by PubChem (NCBI)