CAS 214746-56-2 is the registry number for 6-Chloro-2-naphthaldehyde, 98+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
6-chloronaphthalene-2-carbaldehyde (CAS 214746-56-2) is a chemical compound with the molecular formula C11H7ClO and a molecular weight of 190.62 g/mol. IUPAC name: 6-chloronaphthalene-2-carbaldehyde. InChIKey: LTAQGUGNWJBFTN-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO |
|---|---|
| Molecular weight | 190.62 g/mol |
| IUPAC name | 6-chloronaphthalene-2-carbaldehyde |
| InChIKey | LTAQGUGNWJBFTN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Cl)C=C1C=O |
Computed by PubChem (NCBI)