CAS 879-18-5 appears in our catalog under these names: 1-Naphthoyl Chloride, 1–Naphthoyl chloride, 1-Naphthoyl chloride, 98% , 1-Naphthoyl Chloride, >98.0%(GC)(T), 1-Naphthoyl chloride, 99%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 10g, 25g, 50g, 100g, 250g, 500g, 5g.
Naphthalene-1-carbonyl chloride (CAS 879-18-5) is a chemical compound with the molecular formula C11H7ClO and a molecular weight of 190.62 g/mol. IUPAC name: naphthalene-1-carbonyl chloride. InChIKey: NSNPSJGHTQIXDO-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO |
|---|---|
| Molecular weight | 190.62 g/mol |
| IUPAC name | naphthalene-1-carbonyl chloride |
| InChIKey | NSNPSJGHTQIXDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)Cl |
Computed by PubChem (NCBI)