CAS 2243-83-6 appears in our catalog under these names: 2–Naphthoyl chloride, 2-Naphthoyl chloride, 98% , 2-Naphthoyl Chloride, >98.0%(GC)(T), 2-Naphthoyl chloride, 2-Naphthoyl chloride, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Thermo Scientific (Acros). Available pack sizes: 100g, 250g, 500g, 10g, 50g, 25g, 5000g, 5g.
Naphthalene-2-carbonyl chloride (CAS 2243-83-6) is a chemical compound with the molecular formula C11H7ClO and a molecular weight of 190.62 g/mol. IUPAC name: naphthalene-2-carbonyl chloride. InChIKey: XNLBCXGRQWUJLU-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO |
|---|---|
| Molecular weight | 190.62 g/mol |
| IUPAC name | naphthalene-2-carbonyl chloride |
| InChIKey | XNLBCXGRQWUJLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)Cl |
Computed by PubChem (NCBI)