CAS 2148928-39-4 appears in our catalog under these names: Monochloro-BPF, Monochlorobisphenol F. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
2-chloro-4-[(4-hydroxyphenyl)methyl]phenol (CAS 2148928-39-4) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 2-chloro-4-[(4-hydroxyphenyl)methyl]phenol. InChIKey: PCRSBYPJWNNPMW-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-chloro-4-[(4-hydroxyphenyl)methyl]phenol |
| InChIKey | PCRSBYPJWNNPMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC(=C(C=C2)O)Cl)O |
Computed by PubChem (NCBI)