CAS 2150-40-5 appears in our catalog under these names: Methyl 2,5-dimethoxybenzoate, 98%, METHYL 2，5–DIMETHOXYBENZOATE, Methyl 2,5-dimethoxybenzoate 95%, METHYL 2，5-DIMETHOXYBENZOATE, 95%, 95%, Methyl 2,5-dimethoxybenzoate, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg.
Methyl 2,5-dimethoxybenzoate (CAS 2150-40-5) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2,5-dimethoxybenzoate. InChIKey: AKAPOSLZQKGWGT-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2,5-dimethoxybenzoate |
| InChIKey | AKAPOSLZQKGWGT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)OC |
Computed by PubChem (NCBI)