CAS 2150489-13-5 is the registry number for (5-chloro-2-pyridyl)methyl 4-methylbenzenesulfonate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(5-chloro-2-pyridinyl)methyl 4-methylbenzenesulfonate (CAS 2150489-13-5) is a chemical compound with the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. IUPAC name: (5-chloro-2-pyridinyl)methyl 4-methylbenzenesulfonate. InChIKey: DDFYPZVHWDLCAR-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3S |
|---|---|
| Molecular weight | 297.76 g/mol |
| IUPAC name | (5-chloro-2-pyridinyl)methyl 4-methylbenzenesulfonate |
| InChIKey | DDFYPZVHWDLCAR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)