CAS 1082469-82-6 is the registry number for N-(3-Chloro-2-methylphenyl)-4-hydroxybenzene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(3-chloro-2-methylphenyl)-4-hydroxybenzenesulfonamide (CAS 1082469-82-6) is a chemical compound with the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. IUPAC name: N-(3-chloro-2-methylphenyl)-4-hydroxybenzenesulfonamide. InChIKey: FYMDUVPWZZOTSW-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3S |
|---|---|
| Molecular weight | 297.76 g/mol |
| IUPAC name | N-(3-chloro-2-methylphenyl)-4-hydroxybenzenesulfonamide |
| InChIKey | FYMDUVPWZZOTSW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)NS(=O)(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)