CAS 1094685-51-4 appears in our catalog under these names: 2-({(5-(4-chlorophenyl)-1,3-oxazol-2-yl)methyl}sulfanyl)propanoic acid, 95%, 2-({(5-(4-Chlorophenyl)-1,3-oxazol-2-yl)methyl}sulfanyl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]propanoic acid (CAS 1094685-51-4) is a chemical compound with the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. IUPAC name: 2-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]propanoic acid. InChIKey: XQNVKJQDDKBJFO-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3S |
|---|---|
| Molecular weight | 297.76 g/mol |
| IUPAC name | 2-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]propanoic acid |
| InChIKey | XQNVKJQDDKBJFO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SCC1=NC=C(O1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)