CAS 1096973-86-2 appears in our catalog under these names: 4-((2-Chlorophenyl)methoxy)benzene-1-sulfonamide, 4-((2-Chlorophenyl)methoxy)benzene-1-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
4-[(2-chlorophenyl)methoxy]benzenesulfonamide (CAS 1096973-86-2) is a chemical compound with the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. IUPAC name: 4-[(2-chlorophenyl)methoxy]benzenesulfonamide. InChIKey: QAPAKWSKBHXOBJ-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3S |
|---|---|
| Molecular weight | 297.76 g/mol |
| IUPAC name | 4-[(2-chlorophenyl)methoxy]benzenesulfonamide |
| InChIKey | QAPAKWSKBHXOBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=C(C=C2)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)