CAS 2151-18-0 is the registry number for Barnol. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 100mg, 250mg.
5-ethyl-4,6-dimethylbenzene-1,2,3-triol (CAS 2151-18-0) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 5-ethyl-4,6-dimethylbenzene-1,2,3-triol. InChIKey: BEJSXIVJAKNLMS-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 5-ethyl-4,6-dimethylbenzene-1,2,3-triol |
| InChIKey | BEJSXIVJAKNLMS-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C(=C1C)O)O)O)C |
Computed by PubChem (NCBI)