Products 2151127-61-4
CAS 2151127-61-4 appears in our catalog under these names: Metaraminol Impurity 15, Metaraminol Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(2S)-1-oxo-1-(3-phenylmethoxyphenyl)propan-2-yl]carbamate (CAS 2151127-61-4) is a chemical compound with the molecular formula C24H23NO4 and a molecular weight of 389.4 g/mol. IUPAC name: benzyl N-[(2S)-1-oxo-1-(3-phenylmethoxyphenyl)propan-2-yl]carbamate. InChIKey: UYDYXUXPQKPZNZ-SFHVURJKSA-N.
| Molecular formula | C24H23NO4 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | benzyl N-[(2S)-1-oxo-1-(3-phenylmethoxyphenyl)propan-2-yl]carbamate |
| InChIKey | UYDYXUXPQKPZNZ-SFHVURJKSA-N |
| SMILES | C[C@@H](C(=O)C1=CC(=CC=C1)OCC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)