Products 36270-04-9

CAS 36270-04-9 is the registry number for methyl 5-(dibenzylglycyl)-2-hydroxybenzoat. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5-[2-(dibenzylamino)acetyl]-2-hydroxybenzoate (CAS 36270-04-9) is a chemical compound with the molecular formula C24H23NO4 and a molecular weight of 389.4 g/mol. IUPAC name: methyl 5-[2-(dibenzylamino)acetyl]-2-hydroxybenzoate. InChIKey: CTTFXICXGSXPRG-UHFFFAOYSA-N.

Identity
Molecular formulaC24H23NO4
Molecular weight389.4 g/mol
IUPAC namemethyl 5-[2-(dibenzylamino)acetyl]-2-hydroxybenzoate
InChIKeyCTTFXICXGSXPRG-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)C(=O)CN(CC2=CC=CC=C2)CC3=CC=CC=C3)O

Computed by PubChem (NCBI)