CAS 60379-01-3 is the registry number for Z-Phe-OBzl. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
Benzyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (CAS 60379-01-3) is a chemical compound with the molecular formula C24H23NO4 and a molecular weight of 389.4 g/mol. IUPAC name: benzyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: ILHGLRRAUKTLLN-QFIPXVFZSA-N.
| Molecular formula | C24H23NO4 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | benzyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | ILHGLRRAUKTLLN-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)OCC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)