Products 215122-16-0
CAS 215122-16-0 is the registry number for 2-(Trifluoromethyl)-2H-chromene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (CAS 215122-16-0) is a chemical compound with the molecular formula C11H7F3O3 and a molecular weight of 244.17 g/mol. IUPAC name: 2-(trifluoromethyl)-2H-chromene-3-carboxylic acid. InChIKey: QSLSQLYQCKEGMS-UHFFFAOYSA-N.
| Molecular formula | C11H7F3O3 |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | 2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| InChIKey | QSLSQLYQCKEGMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(O2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)