Products 2151834-34-1
CAS 2151834-34-1 appears in our catalog under these names: 8-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine, 98%, 98%, 8-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
8-bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine (CAS 2151834-34-1) is a chemical compound with the molecular formula C7H3BrF3N3 and a molecular weight of 266.02 g/mol. IUPAC name: 8-bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine. InChIKey: QLJWBOVFKXDBKU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3N3 |
|---|---|
| Molecular weight | 266.02 g/mol |
| IUPAC name | 8-bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine |
| InChIKey | QLJWBOVFKXDBKU-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(N=C2C(F)(F)F)Br)N=C1 |
Computed by PubChem (NCBI)