CAS 2152821-28-6 is the registry number for 5-Bromo-1-cyclopropanesulfonyl-2,3-dihydro-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-1-cyclopropylsulfonyl-2,3-dihydroindole (CAS 2152821-28-6) is a chemical compound with the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. IUPAC name: 5-bromo-1-cyclopropylsulfonyl-2,3-dihydroindole. InChIKey: NOOZIWAUAGURJZ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2S |
|---|---|
| Molecular weight | 302.19 g/mol |
| IUPAC name | 5-bromo-1-cyclopropylsulfonyl-2,3-dihydroindole |
| InChIKey | NOOZIWAUAGURJZ-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)N2CCC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)