CAS 2581105-27-1 is the registry number for Ethyl 7-bromo-3,4-dihydro-2H-benzo[b][1,4]thiazine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7-bromo-3,4-dihydro-2H-1,4-benzothiazine-3-carboxylate (CAS 2581105-27-1) is a chemical compound with the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. IUPAC name: ethyl 7-bromo-3,4-dihydro-2H-1,4-benzothiazine-3-carboxylate. InChIKey: MCGVVAATFOCPQK-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2S |
|---|---|
| Molecular weight | 302.19 g/mol |
| IUPAC name | ethyl 7-bromo-3,4-dihydro-2H-1,4-benzothiazine-3-carboxylate |
| InChIKey | MCGVVAATFOCPQK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CSC2=C(N1)C=CC(=C2)Br |
Computed by PubChem (NCBI)