CAS 55775-26-3 is the registry number for 3-(2-Carboxyethyl)-2-methylbenzo[d]thiazol-3-ium bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid bromide (CAS 55775-26-3) is a chemical compound with the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. IUPAC name: 3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid bromide. InChIKey: CVSMVTYNERUSSW-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2S |
|---|---|
| Molecular weight | 302.19 g/mol |
| IUPAC name | 3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoic acid bromide |
| InChIKey | CVSMVTYNERUSSW-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=CC=CC=C2S1)CCC(=O)O.[Br-] |
Computed by PubChem (NCBI)