Products 2153286-34-9
CAS 2153286-34-9 appears in our catalog under these names: 5-[2-Chloro-6-(trifluoromethyl)phenyl]-1,3-oxazole, 95%, 5-[2-Chloro-6-(trifluoromethyl)phenyl]-1,3-oxazole, ≥95%, ≥95%, 5-[2-Chloro-6-(trifluoromethyl)phenyl]-1,3-oxazole. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
5-[2-chloro-6-(trifluoromethyl)phenyl]-1,3-oxazole (CAS 2153286-34-9) is a chemical compound with the molecular formula C10H5ClF3NO and a molecular weight of 247.60 g/mol. IUPAC name: 5-[2-chloro-6-(trifluoromethyl)phenyl]-1,3-oxazole. InChIKey: RUBQRUAZXKSDAE-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF3NO |
|---|---|
| Molecular weight | 247.60 g/mol |
| IUPAC name | 5-[2-chloro-6-(trifluoromethyl)phenyl]-1,3-oxazole |
| InChIKey | RUBQRUAZXKSDAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=CN=CO2)C(F)(F)F |
Computed by PubChem (NCBI)