Products 40516-31-2
CAS 40516-31-2 is the registry number for 4-Chloro-7-(trifluoromethoxy)quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-chloro-7-(trifluoromethoxy)quinoline (CAS 40516-31-2) is a chemical compound with the molecular formula C10H5ClF3NO and a molecular weight of 247.60 g/mol. IUPAC name: 4-chloro-7-(trifluoromethoxy)quinoline. InChIKey: IMYQYVHUVHLCOX-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF3NO |
|---|---|
| Molecular weight | 247.60 g/mol |
| IUPAC name | 4-chloro-7-(trifluoromethoxy)quinoline |
| InChIKey | IMYQYVHUVHLCOX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1OC(F)(F)F)Cl |
Computed by PubChem (NCBI)