Products 676477-10-4
CAS 676477-10-4 appears in our catalog under these names: 1-(6-Chloro-3-indolyl)-2,2,2-trifluoroethanone, 95%, 1-(6-Chloro-1H-indol-3-yl)-2,2,2-trifluoroethan-1-one, 95%, 1-(6-Chloro-1H-indol-3-yl)-2,2,2-trifluoroethan-1-one, ≥95%, ≥95%, 1-(6-Chloro-1H-indol-3-yl)-2,2,2-trifluoroethan-1-one. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g.
1-(6-chloro-1H-indol-3-yl)-2,2,2-trifluoroethanone (CAS 676477-10-4) is a chemical compound with the molecular formula C10H5ClF3NO and a molecular weight of 247.60 g/mol. IUPAC name: 1-(6-chloro-1H-indol-3-yl)-2,2,2-trifluoroethanone. InChIKey: DOCNWGLGOYLWRC-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF3NO |
|---|---|
| Molecular weight | 247.60 g/mol |
| IUPAC name | 1-(6-chloro-1H-indol-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | DOCNWGLGOYLWRC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C2C(=O)C(F)(F)F |
Computed by PubChem (NCBI)