CAS 215436-29-6 appears in our catalog under these names: Methyl 5-(tert-butyl)picolinate, 95+%, Methyl 5-(tert-butyl)picolinate, 95%, 95%, Methyl 5-(tert-butyl)picolinate, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g.
Methyl 5-tert-butylpyridine-2-carboxylate (CAS 215436-29-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: methyl 5-tert-butylpyridine-2-carboxylate. InChIKey: JRXBWYKPWHPFQO-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | methyl 5-tert-butylpyridine-2-carboxylate |
| InChIKey | JRXBWYKPWHPFQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)