Products 2155840-79-0
CAS 2155840-79-0 is the registry number for (1R)-1-((3R)-Morpholin-3-yl)ethane-1,2-diol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R)-1-[(3R)-morpholin-3-yl]ethane-1,2-diol;hydrochloride (CAS 2155840-79-0) is a chemical compound with the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. IUPAC name: (1R)-1-[(3R)-morpholin-3-yl]ethane-1,2-diol;hydrochloride. InChIKey: KUFWAMRXPILATC-IBTYICNHSA-N.
| Molecular formula | C6H14ClNO3 |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (1R)-1-[(3R)-morpholin-3-yl]ethane-1,2-diol;hydrochloride |
| InChIKey | KUFWAMRXPILATC-IBTYICNHSA-N |
| SMILES | C1COC[C@@H](N1)[C@H](CO)O.Cl |
Computed by PubChem (NCBI)