Products 2155852-20-1
CAS 2155852-20-1 is the registry number for 2-(5-Methylpyridin-2-yl)propan-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(5-methyl-2-pyridinyl)propan-2-ol;hydrochloride (CAS 2155852-20-1) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: 2-(5-methyl-2-pyridinyl)propan-2-ol;hydrochloride. InChIKey: VDVWWIRQLGTFFP-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | 2-(5-methyl-2-pyridinyl)propan-2-ol;hydrochloride |
| InChIKey | VDVWWIRQLGTFFP-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)C(C)(C)O.Cl |
Computed by PubChem (NCBI)